Products 303008-80-2
CAS 303008-80-2 is the registry number for Pandamarilactonine A. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, Get quote.
(5Z)-3-methyl-5-[4-[(2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidin-1-yl]butylidene]furan-2-one (CAS 303008-80-2) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: (5Z)-3-methyl-5-[4-[(2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidin-1-yl]butylidene]furan-2-one. InChIKey: HSICZNIIIPFAAO-UPYRFZFASA-N.
| Molecular formula | C18H23NO4 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (5Z)-3-methyl-5-[4-[(2R)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]pyrrolidin-1-yl]butylidene]furan-2-one |
| InChIKey | HSICZNIIIPFAAO-UPYRFZFASA-N |
| SMILES | CC1=C[C@@H](OC1=O)[C@H]2CCCN2CCC/C=C\3/C=C(C(=O)O3)C |
Computed by PubChem (NCBI)
Synonyms:
Pandamarilactonine A, orb1943213