CAS 303176-45-6 appears in our catalog under these names: Nebivolol Impurity 52, (1’R,2R)-2-(1’,2’-Dihydroxyethyl)-6-fluorochromane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(1R)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethane-1,2-diol (CAS 303176-45-6) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: (1R)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethane-1,2-diol. InChIKey: GCGMAEKAEXMJNG-MWLCHTKSSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | (1R)-1-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethane-1,2-diol |
| InChIKey | GCGMAEKAEXMJNG-MWLCHTKSSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@H]1[C@@H](CO)O |
Computed by PubChem (NCBI)