CAS 905454-57-1 is the registry number for Nebivolol Impurity 51. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[(2S)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethane-1,2-diol (CAS 905454-57-1) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: (1S)-1-[(2S)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethane-1,2-diol. InChIKey: GCGMAEKAEXMJNG-ONGXEEELSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | (1S)-1-[(2S)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethane-1,2-diol |
| InChIKey | GCGMAEKAEXMJNG-ONGXEEELSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)O[C@@H]1[C@H](CO)O |
Computed by PubChem (NCBI)