CAS 303215-59-0 is the registry number for N'-(1-(3-Aminophenyl)ethylidene)thiophene-2-carbohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(Z)-1-(3-aminophenyl)ethylideneamino]thiophene-2-carboxamide (CAS 303215-59-0) is a chemical compound with the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. IUPAC name: N-[(Z)-1-(3-aminophenyl)ethylideneamino]thiophene-2-carboxamide. InChIKey: PMLFYBIRTNZFGK-DHDCSXOGSA-N.
| Molecular formula | C13H13N3OS |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | N-[(Z)-1-(3-aminophenyl)ethylideneamino]thiophene-2-carboxamide |
| InChIKey | PMLFYBIRTNZFGK-DHDCSXOGSA-N |
| SMILES | C/C(=N/NC(=O)C1=CC=CS1)/C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)