CAS 869464-91-5 is the registry number for 1-(4-(2-Amino-1,3-thiazol-4-yl)phenyl)pyrrolidin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one (CAS 869464-91-5) is a chemical compound with the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. IUPAC name: 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one. InChIKey: OFSONEPCPBZQRA-UHFFFAOYSA-N.
| Molecular formula | C13H13N3OS |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one |
| InChIKey | OFSONEPCPBZQRA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)