CAS 324055-33-6 is the registry number for 1-(1,3-Benzothiazol-2-yl)-3-propyl-1h-pyrazol-5-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
1-[(E)-furan-2-ylmethylideneamino]-3-(3-methylphenyl)thiourea (CAS 324055-33-6) is a chemical compound with the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. IUPAC name: 1-[(E)-furan-2-ylmethylideneamino]-3-(3-methylphenyl)thiourea. InChIKey: KXLGFSQJDTYOEJ-NTEUORMPSA-N.
| Molecular formula | C13H13N3OS |
|---|---|
| Molecular weight | 259.33 g/mol |
| IUPAC name | 1-[(E)-furan-2-ylmethylideneamino]-3-(3-methylphenyl)thiourea |
| InChIKey | KXLGFSQJDTYOEJ-NTEUORMPSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=S)N/N=C/C2=CC=CO2 |
Computed by PubChem (NCBI)