Products 3032601-06-9
CAS 3032601-06-9 is the registry number for BRD7-IN-2, 99.21%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10 mg, 100 mg.
7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one (CAS 3032601-06-9) is a chemical compound with the molecular formula C18H18N2O3 and a molecular weight of 310.3 g/mol. IUPAC name: 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one. InChIKey: NFFBUIFLOKMWKQ-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O3 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 7-(2,6-dimethoxy-3-pyridinyl)-1,4-dimethylquinolin-2-one |
| InChIKey | NFFBUIFLOKMWKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=C1C=CC(=C2)C3=C(N=C(C=C3)OC)OC)C |
Computed by PubChem (NCBI)