Products 30367-61-4
CAS 30367-61-4 appears in our catalog under these names: 4-Acetamidobicyclo[2.2.2]octane-1-carboxylic acid, 95%, 4-(Acetylamino)-bicyclo(2.2.2)octane-1-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-acetamidobicyclo[2.2.2]octane-1-carboxylic acid (CAS 30367-61-4) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: 4-acetamidobicyclo[2.2.2]octane-1-carboxylic acid. InChIKey: VHDJITVKFZXMHR-UHFFFAOYSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 4-acetamidobicyclo[2.2.2]octane-1-carboxylic acid |
| InChIKey | VHDJITVKFZXMHR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC12CCC(CC1)(CC2)C(=O)O |
Computed by PubChem (NCBI)