Products 3038542-51-4
CAS 3038542-51-4 is the registry number for RA-0002034, 99.48%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10 mg.
3-(2-ethoxyphenyl)-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-5-carboxamide (CAS 3038542-51-4) is a chemical compound with the molecular formula C16H19N3O4S and a molecular weight of 349.4 g/mol. IUPAC name: 3-(2-ethoxyphenyl)-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-5-carboxamide. InChIKey: KNZUNPRTZJZIHO-UXBLZVDNSA-N.
| Molecular formula | C16H19N3O4S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 3-(2-ethoxyphenyl)-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-5-carboxamide |
| InChIKey | KNZUNPRTZJZIHO-UXBLZVDNSA-N |
| SMILES | CCOC1=CC=CC=C1C2=NNC(=C2)C(=O)NC/C=C/S(=O)(=O)C |
Computed by PubChem (NCBI)