CAS 30405-75-5 is the registry number for 1,2-Dimethoxy-4-(prop-1-en-2-yl)benzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,2-dimethoxy-4-prop-1-en-2-ylbenzene (CAS 30405-75-5) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 1,2-dimethoxy-4-prop-1-en-2-ylbenzene. InChIKey: PRHTXAOWJQTLBO-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 1,2-dimethoxy-4-prop-1-en-2-ylbenzene |
| InChIKey | PRHTXAOWJQTLBO-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)