Products 30435-75-7
CAS 30435-75-7 is the registry number for 1-Bromo-2-methoxy-5-methyl-3-nitrobenzene, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-methoxy-5-methyl-3-nitrobenzene (CAS 30435-75-7) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 1-bromo-2-methoxy-5-methyl-3-nitrobenzene. InChIKey: CMLYAHYWAINDLT-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 1-bromo-2-methoxy-5-methyl-3-nitrobenzene |
| InChIKey | CMLYAHYWAINDLT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)