CAS 304476-31-1 appears in our catalog under these names: Toluene-4-sulfonic acid benzothiazol-2-ylmethyl ester, 95%, 1,3-Benzothiazol-2-ylmethyl 4-methylbenzene-1-sulfonate, 95%, 1,3-Benzothiazol-2-ylmethyl 4-methylbenzene-1-sulfonate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1,3-benzothiazol-2-ylmethyl 4-methylbenzenesulfonate (CAS 304476-31-1) is a chemical compound with the molecular formula C15H13NO3S2 and a molecular weight of 319.4 g/mol. IUPAC name: 1,3-benzothiazol-2-ylmethyl 4-methylbenzenesulfonate. InChIKey: GGDQIPHYCSLYFW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 1,3-benzothiazol-2-ylmethyl 4-methylbenzenesulfonate |
| InChIKey | GGDQIPHYCSLYFW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)