CAS 3285-53-8 is the registry number for N,N-Dimethyl-9-oxo-9H-thioxanthene-2-sulfonamide. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 100mg.
N,N-dimethyl-9-oxothioxanthene-2-sulfonamide (CAS 3285-53-8) is a chemical compound with the molecular formula C15H13NO3S2 and a molecular weight of 319.4 g/mol. IUPAC name: N,N-dimethyl-9-oxothioxanthene-2-sulfonamide. InChIKey: LSCIJUOPVFDTTJ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO3S2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | N,N-dimethyl-9-oxothioxanthene-2-sulfonamide |
| InChIKey | LSCIJUOPVFDTTJ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)