Products 3046152-58-0
CAS 3046152-58-0 is the registry number for Methyl 4-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 3046152-58-0) is a chemical compound with the molecular formula C16H23BO5 and a molecular weight of 306.2 g/mol. IUPAC name: methyl 4-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: MUQDJRIESXDUKU-UHFFFAOYSA-N.
| Molecular formula | C16H23BO5 |
|---|---|
| Molecular weight | 306.2 g/mol |
| IUPAC name | methyl 4-ethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | MUQDJRIESXDUKU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)OCC |
Computed by PubChem (NCBI)