CAS 304876-39-9 is the registry number for 5'-Bromo-1',2'-dihydrospiro(cyclobutane-1,3'-indol)-2'-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromospiro[1H-indole-3,1'-cyclobutane]-2-one (CAS 304876-39-9) is a chemical compound with the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. IUPAC name: 5-bromospiro[1H-indole-3,1'-cyclobutane]-2-one. InChIKey: OGJCYNMPDRGBDF-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 5-bromospiro[1H-indole-3,1'-cyclobutane]-2-one |
| InChIKey | OGJCYNMPDRGBDF-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)C3=C(C=CC(=C3)Br)NC2=O |
Computed by PubChem (NCBI)