CAS 304884-73-9 is the registry number for N-(2,6-Dichlorophenyl)-2-fluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,6-dichlorophenyl)-2-fluorobenzamide (CAS 304884-73-9) is a chemical compound with the molecular formula C13H8Cl2FNO and a molecular weight of 284.11 g/mol. IUPAC name: N-(2,6-dichlorophenyl)-2-fluorobenzamide. InChIKey: CSQKIRJRBCAPIY-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2FNO |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)-2-fluorobenzamide |
| InChIKey | CSQKIRJRBCAPIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(C=CC=C2Cl)Cl)F |
Computed by PubChem (NCBI)