CAS 349128-37-6 is the registry number for 3-Chloro-n-(3-chloro-4-fluorophenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-N-(3-chloro-4-fluorophenyl)benzamide (CAS 349128-37-6) is a chemical compound with the molecular formula C13H8Cl2FNO and a molecular weight of 284.11 g/mol. IUPAC name: 3-chloro-N-(3-chloro-4-fluorophenyl)benzamide. InChIKey: WMGYJRNTVAXRFB-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2FNO |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 3-chloro-N-(3-chloro-4-fluorophenyl)benzamide |
| InChIKey | WMGYJRNTVAXRFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)NC2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)