CAS 330469-05-1 is the registry number for N-(3,5-Dichlorophenyl)-2-fluorobenzamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,5-dichlorophenyl)-2-fluorobenzamide (CAS 330469-05-1) is a chemical compound with the molecular formula C13H8Cl2FNO and a molecular weight of 284.11 g/mol. IUPAC name: N-(3,5-dichlorophenyl)-2-fluorobenzamide. InChIKey: HHJINMSUUDJELX-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2FNO |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | N-(3,5-dichlorophenyl)-2-fluorobenzamide |
| InChIKey | HHJINMSUUDJELX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=CC(=C2)Cl)Cl)F |
Computed by PubChem (NCBI)