CAS 304887-43-2 is the registry number for N-(3,4-Dimethylphenyl)-2-oxo-2H-chromene-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(3,4-dimethylphenyl)-2-oxochromene-3-carboxamide (CAS 304887-43-2) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-2-oxochromene-3-carboxamide. InChIKey: VUJINTDHHNCFJN-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-2-oxochromene-3-carboxamide |
| InChIKey | VUJINTDHHNCFJN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC3=CC=CC=C3OC2=O)C |
Computed by PubChem (NCBI)