Products 693815-64-4

CAS 693815-64-4 is the registry number for 3-((4-(Hydroxymethyl)-2-methoxyphenoxy)methyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[[4-(hydroxymethyl)-2-methoxyphenoxy]methyl]benzoic acid (CAS 693815-64-4) is a chemical compound with the molecular formula C16H16O5 and a molecular weight of 288.29 g/mol. IUPAC name: 3-[[4-(hydroxymethyl)-2-methoxyphenoxy]methyl]benzoic acid. InChIKey: SADGBEHXOTUSIV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O5
Molecular weight288.29 g/mol
IUPAC name3-[[4-(hydroxymethyl)-2-methoxyphenoxy]methyl]benzoic acid
InChIKeySADGBEHXOTUSIV-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)CO)OCC2=CC(=CC=C2)C(=O)O

Computed by PubChem (NCBI)