CAS 304904-61-8 appears in our catalog under these names: 6,7-Dimethoxy-3h-quinolin-4-one, 95%, 6,7–DIMETHOXY–3H–QUINOLIN–4–ONE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 100g, 25g, 500g, 200mg.
6,7-dimethoxy-3H-quinolin-4-one (CAS 304904-61-8) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 6,7-dimethoxy-3H-quinolin-4-one. InChIKey: GOPZXZSDYBVSQO-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 6,7-dimethoxy-3H-quinolin-4-one |
| InChIKey | GOPZXZSDYBVSQO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)CC=N2)OC |
Computed by PubChem (NCBI)