CAS 30515-75-4 is the registry number for 1-(7-Methylimidazo[1,2-a]pyridin-3-yl)ethanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(7-methylimidazo[1,2-a]pyridin-3-yl)ethanone (CAS 30515-75-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1-(7-methylimidazo[1,2-a]pyridin-3-yl)ethanone. InChIKey: RIWXTIDVNVIKQK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1-(7-methylimidazo[1,2-a]pyridin-3-yl)ethanone |
| InChIKey | RIWXTIDVNVIKQK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(N2C=C1)C(=O)C |
Computed by PubChem (NCBI)