Products 30545-18-7
CAS 30545-18-7 is the registry number for Diamantane-1-carboxylic Acid. Offered by: TRC. Available pack sizes: 50mg.
Pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-carboxylic acid (CAS 30545-18-7) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-carboxylic acid. InChIKey: BUVACXIHXVLWSC-UHFFFAOYSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1-carboxylic acid |
| InChIKey | BUVACXIHXVLWSC-UHFFFAOYSA-N |
| SMILES | C1C2CC3C4C1C5CC(C4)CC3(C5C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Diadamantylcarboxylic acid