CAS 305806-38-6 appears in our catalog under these names: 4-(1-Methyl-5-imidazolyl)benzoic acid, 95%, 4–(1–Methyl–5–imidazolyl)benzoic Acid, 4-(1-Methyl-1H-imidazol-5-yl)benzoic acid, >95%, >95%, 4-(1-Methyl-1H-imidazol-5-yl)benzoic acid, >95%, 4-(1-Methyl-5-imidazolyl)benzoic Acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
4-(3-methylimidazol-4-yl)benzoic acid (CAS 305806-38-6) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 4-(3-methylimidazol-4-yl)benzoic acid. InChIKey: VRUJRMUIEJAVSP-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-(3-methylimidazol-4-yl)benzoic acid |
| InChIKey | VRUJRMUIEJAVSP-UHFFFAOYSA-N |
| SMILES | CN1C=NC=C1C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)