CAS 3058906-46-7 is the registry number for KCC2 potentiators-1, 97.45%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 50 mg, 10 mg, 100 mg, 25 mg, 5 mg.
2-[(2,4-dimethyl-3-pyridinyl)methylsulfanyl]-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (CAS 3058906-46-7) is a chemical compound with the molecular formula C15H17N3OS and a molecular weight of 287.4 g/mol. IUPAC name: 2-[(2,4-dimethyl-3-pyridinyl)methylsulfanyl]-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one. InChIKey: MRTIFRBYXDXUNF-UHFFFAOYSA-N.
| Molecular formula | C15H17N3OS |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2-[(2,4-dimethyl-3-pyridinyl)methylsulfanyl]-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| InChIKey | MRTIFRBYXDXUNF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)C)CSC2=NC3=C(CCC3)C(=O)N2 |
Computed by PubChem (NCBI)