CAS 893302-36-8 is the registry number for N-(2,6-Dimethylphenyl)-4-methyl-2-(methylthio)pyrimidine-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,6-dimethylphenyl)-4-methyl-2-methylsulfanylpyrimidine-5-carboxamide (CAS 893302-36-8) is a chemical compound with the molecular formula C15H17N3OS and a molecular weight of 287.4 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-4-methyl-2-methylsulfanylpyrimidine-5-carboxamide. InChIKey: AZOMYPIEZNLHSN-UHFFFAOYSA-N.
| Molecular formula | C15H17N3OS |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-4-methyl-2-methylsulfanylpyrimidine-5-carboxamide |
| InChIKey | AZOMYPIEZNLHSN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=CN=C(N=C2C)SC |
Computed by PubChem (NCBI)