CAS 34959-32-5 is the registry number for 2-Amino-6-benzyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (CAS 34959-32-5) is a chemical compound with the molecular formula C15H17N3OS and a molecular weight of 287.4 g/mol. IUPAC name: 2-amino-6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide. InChIKey: LGGWACZZAOTYKK-UHFFFAOYSA-N.
| Molecular formula | C15H17N3OS |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2-amino-6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| InChIKey | LGGWACZZAOTYKK-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=C(S2)N)C(=O)N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)