Products 306296-76-4
CAS 306296-76-4 appears in our catalog under these names: 4–Formyl–2，6–dimethylbenzoic acid, 4-Formyl-2,6-dimethylbenzoic acid, 4-Formyl-2,6-dimethylbenzoic acid, 98%, 4-Formyl-2,6-dimethylbenzoic acid, 97%, 2,6-Dimethyl-4-formyl-benzoic acid, ≥98%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, BLDpharm. Available pack sizes: 100mg, 2g, 1g, 5g, 10g, 250mg.
4-formyl-2,6-dimethylbenzoic acid (CAS 306296-76-4) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-formyl-2,6-dimethylbenzoic acid. InChIKey: IZLUAIAAIWYAHL-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-formyl-2,6-dimethylbenzoic acid |
| InChIKey | IZLUAIAAIWYAHL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)C=O |
Computed by PubChem (NCBI)