Products 306749-60-0
CAS 306749-60-0 appears in our catalog under these names: 2-Isopropylquinoline-4-carboxylic acid, 95%, 2-Isopropylquinoline-4-carboxylic acid, 97%, 2-isopropylquinoline-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 500mg, 25g.
2-propan-2-ylquinoline-4-carboxylic acid (CAS 306749-60-0) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 2-propan-2-ylquinoline-4-carboxylic acid. InChIKey: ZHQZYLFXDJYBGO-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-propan-2-ylquinoline-4-carboxylic acid |
| InChIKey | ZHQZYLFXDJYBGO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=CC=CC=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)