CAS 3068-29-9 appears in our catalog under these names: (2S,3S,4R,5R)-2-Bromotetrahydro-2H-pyran-3,4,5-triyl triacetate, 97%, (2S,3S,4R,5R)-2-Bromotetrahydro-2H-pyran-3,4,5-triyl triacetate, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 25g.
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate (CAS 3068-29-9) is a chemical compound with the molecular formula C11H15BrO7 and a molecular weight of 339.14 g/mol. IUPAC name: [(3R,4R,5S,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate. InChIKey: AVNRQUICFRHQDY-CHWFTXMASA-N.
| Molecular formula | C11H15BrO7 |
|---|---|
| Molecular weight | 339.14 g/mol |
| IUPAC name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate |
| InChIKey | AVNRQUICFRHQDY-CHWFTXMASA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)Br |
Computed by PubChem (NCBI)