CAS 75247-31-3 is the registry number for 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 5g.
[(3S,4S,5R,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate (CAS 75247-31-3) is a chemical compound with the molecular formula C11H15BrO7 and a molecular weight of 339.14 g/mol. IUPAC name: [(3S,4S,5R,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate. InChIKey: AVNRQUICFRHQDY-UKKRHICBSA-N.
| Molecular formula | C11H15BrO7 |
|---|---|
| Molecular weight | 339.14 g/mol |
| IUPAC name | [(3S,4S,5R,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate |
| InChIKey | AVNRQUICFRHQDY-UKKRHICBSA-N |
| SMILES | CC(=O)O[C@H]1CO[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)Br |
Computed by PubChem (NCBI)