Products 75247-31-3

CAS 75247-31-3 is the registry number for 2,3,4-Tri-O-acetyl-α-L-arabinopyranosyl bromide. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 5g.

Structural formula: {0} (CAS {1})

[(3S,4S,5R,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate (CAS 75247-31-3) is a chemical compound with the molecular formula C11H15BrO7 and a molecular weight of 339.14 g/mol. IUPAC name: [(3S,4S,5R,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate. InChIKey: AVNRQUICFRHQDY-UKKRHICBSA-N.

Identity
Molecular formulaC11H15BrO7
Molecular weight339.14 g/mol
IUPAC name[(3S,4S,5R,6S)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate
InChIKeyAVNRQUICFRHQDY-UKKRHICBSA-N
SMILESCC(=O)O[C@H]1CO[C@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)Br

Computed by PubChem (NCBI)