CAS 51830-02-5 is the registry number for (3R,4S,5S)-2-Bromotetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[(3S,4S,5R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate (CAS 51830-02-5) is a chemical compound with the molecular formula C11H15BrO7 and a molecular weight of 339.14 g/mol. IUPAC name: [(3S,4S,5R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate. InChIKey: AVNRQUICFRHQDY-GKDVJIACSA-N.
| Molecular formula | C11H15BrO7 |
|---|---|
| Molecular weight | 339.14 g/mol |
| IUPAC name | [(3S,4S,5R)-4,5-diacetyloxy-6-bromooxan-3-yl] acetate |
| InChIKey | AVNRQUICFRHQDY-GKDVJIACSA-N |
| SMILES | CC(=O)O[C@H]1COC([C@@H]([C@H]1OC(=O)C)OC(=O)C)Br |
Computed by PubChem (NCBI)