Products 306818-06-4

CAS 306818-06-4 is the registry number for Ethyl 2-(5-amino-3-tert-butyl-1H-pyrazol-1-yl)acetate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(5-amino-3-tert-butylpyrazol-1-yl)acetate (CAS 306818-06-4) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: ethyl 2-(5-amino-3-tert-butylpyrazol-1-yl)acetate. InChIKey: NKLKNVALGKYXRM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19N3O2
Molecular weight225.29 g/mol
IUPAC nameethyl 2-(5-amino-3-tert-butylpyrazol-1-yl)acetate
InChIKeyNKLKNVALGKYXRM-UHFFFAOYSA-N
SMILESCCOC(=O)CN1C(=CC(=N1)C(C)(C)C)N

Computed by PubChem (NCBI)