CAS 306935-42-2 is the registry number for 1-Isopropyl-2-(trifluoromethyl)-1h-benzimidazole-5-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxylic acid (CAS 306935-42-2) is a chemical compound with the molecular formula C12H11F3N2O2 and a molecular weight of 272.22 g/mol. IUPAC name: 1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxylic acid. InChIKey: AHTNGRMQJZPRNL-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O2 |
|---|---|
| Molecular weight | 272.22 g/mol |
| IUPAC name | 1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxylic acid |
| InChIKey | AHTNGRMQJZPRNL-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=C(C=C2)C(=O)O)N=C1C(F)(F)F |
Computed by PubChem (NCBI)