Products 306935-42-2

CAS 306935-42-2 is the registry number for 1-Isopropyl-2-(trifluoromethyl)-1h-benzimidazole-5-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxylic acid (CAS 306935-42-2) is a chemical compound with the molecular formula C12H11F3N2O2 and a molecular weight of 272.22 g/mol. IUPAC name: 1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxylic acid. InChIKey: AHTNGRMQJZPRNL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11F3N2O2
Molecular weight272.22 g/mol
IUPAC name1-propan-2-yl-2-(trifluoromethyl)benzimidazole-5-carboxylic acid
InChIKeyAHTNGRMQJZPRNL-UHFFFAOYSA-N
SMILESCC(C)N1C2=C(C=C(C=C2)C(=O)O)N=C1C(F)(F)F

Computed by PubChem (NCBI)