CAS 71515-96-3 is the registry number for N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide. Offered by: TRC. Available pack sizes: 100mg.
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide (CAS 71515-96-3) is a chemical compound with the molecular formula C12H11F3N2O2 and a molecular weight of 272.22 g/mol. IUPAC name: N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide. InChIKey: AGWZNPHZMOMBTF-UHFFFAOYSA-N.
| Molecular formula | C12H11F3N2O2 |
|---|---|
| Molecular weight | 272.22 g/mol |
| IUPAC name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide |
| InChIKey | AGWZNPHZMOMBTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=CC(=C(C=C1)C#N)C(F)(F)F)O |
Computed by PubChem (NCBI)