Products 876728-42-6

CAS 876728-42-6 is the registry number for 4-[2-(Trifluoromethyl)-1H-benzimidazol-1-yl]butanoic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-[2-(trifluoromethyl)benzimidazol-1-yl]butanoic acid (CAS 876728-42-6) is a chemical compound with the molecular formula C12H11F3N2O2 and a molecular weight of 272.22 g/mol. IUPAC name: 4-[2-(trifluoromethyl)benzimidazol-1-yl]butanoic acid. InChIKey: HQUSGKZLJZMIHU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11F3N2O2
Molecular weight272.22 g/mol
IUPAC name4-[2-(trifluoromethyl)benzimidazol-1-yl]butanoic acid
InChIKeyHQUSGKZLJZMIHU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)N=C(N2CCCC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)