CAS 3077136-87-6 is the registry number for XH-30. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-amino-2-cyclopropyl-7-(3-hydroxy-2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxamide (CAS 3077136-87-6) is a chemical compound with the molecular formula C19H19N3O3 and a molecular weight of 337.4 g/mol. IUPAC name: 6-amino-2-cyclopropyl-7-(3-hydroxy-2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxamide. InChIKey: LMJMLNIWVIOFRW-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O3 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 6-amino-2-cyclopropyl-7-(3-hydroxy-2,6-dimethylphenyl)-1,3-benzoxazole-5-carboxamide |
| InChIKey | LMJMLNIWVIOFRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C)C2=C(C(=CC3=C2OC(=N3)C4CC4)C(=O)N)N |
Computed by PubChem (NCBI)