CAS 3077856-36-8 is the registry number for 4-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)aniline, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline (CAS 3077856-36-8) is a chemical compound with the molecular formula C18H22BNO3 and a molecular weight of 311.2 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline. InChIKey: IWSGAHSIAWGAQT-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline |
| InChIKey | IWSGAHSIAWGAQT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)