CAS 1171891-09-0 is the registry number for 3-(4-Methoxyphenyl)-5-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
3-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1171891-09-0) is a chemical compound with the molecular formula C18H22BNO3 and a molecular weight of 311.2 g/mol. IUPAC name: 3-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XLFWSSZQZYJZNZ-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XLFWSSZQZYJZNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)