CAS 1073371-81-9 appears in our catalog under these names: 2-Benzyloxypyridine-3-boronic acid pinacol ester, 95%, 2-(Benzyloxy)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073371-81-9) is a chemical compound with the molecular formula C18H22BNO3 and a molecular weight of 311.2 g/mol. IUPAC name: 2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: IFMSDMPTVPMGOP-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 2-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | IFMSDMPTVPMGOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)