Products 1218790-46-5
CAS 1218790-46-5 appears in our catalog under these names: 4-(4-Furfuryliminomethyl)phenylboronic acid pinacol ester, 97%, 4–(4–Furfuryliminomethyl)benzeneboronic acid pinacol ester. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 25g.
N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 1218790-46-5) is a chemical compound with the molecular formula C18H22BNO3 and a molecular weight of 311.2 g/mol. IUPAC name: N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: IIAOBOBJQMILAT-UHFFFAOYSA-N.
| Molecular formula | C18H22BNO3 |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | N-(furan-2-ylmethyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | IIAOBOBJQMILAT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=NCC3=CC=CO3 |
Computed by PubChem (NCBI)