Products 3079242-97-7
CAS 3079242-97-7 is the registry number for 7-Bromo-2,4-dihydropyrazolo[3’,4’:3,4]cyclopenta[1,2-b]pyridine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
11-bromo-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene (CAS 3079242-97-7) is a chemical compound with the molecular formula C9H6BrN3 and a molecular weight of 236.07 g/mol. IUPAC name: 11-bromo-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene. InChIKey: WAICLGSPGMFGJL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 11-bromo-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaene |
| InChIKey | WAICLGSPGMFGJL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=C1N=CC(=C3)Br)NN=C2 |
Computed by PubChem (NCBI)