CAS 307990-29-0 appears in our catalog under these names: 5-Amino-2-cyclopropyl-1h-isoindole-1,3(2h)-dione, 95%, 5-Amino-2-cyclopropylisoindoline-1,3-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-amino-2-cyclopropylisoindole-1,3-dione (CAS 307990-29-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 5-amino-2-cyclopropylisoindole-1,3-dione. InChIKey: ZDBRRTRQZCFUKJ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-amino-2-cyclopropylisoindole-1,3-dione |
| InChIKey | ZDBRRTRQZCFUKJ-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=O)C3=C(C2=O)C=C(C=C3)N |
Computed by PubChem (NCBI)