CAS 3082-69-7 is the registry number for (betaS)-beta-Aminobenzenepropanoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 5g.
Ethyl (3S)-3-amino-3-phenylpropanoate (CAS 3082-69-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: ethyl (3S)-3-amino-3-phenylpropanoate. InChIKey: NUWRDXMXYDWUAN-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | ethyl (3S)-3-amino-3-phenylpropanoate |
| InChIKey | NUWRDXMXYDWUAN-JTQLQIEISA-N |
| SMILES | CCOC(=O)C[C@@H](C1=CC=CC=C1)N |
Computed by PubChem (NCBI)