Products 3082507-74-9
CAS 3082507-74-9 is the registry number for N’-(1-Boc-azetidin-3-yl)-4-methylbenzenesulfonohydrazide, >96%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Tert-butyl 3-[2-(4-methylphenyl)sulfonylhydrazinyl]azetidine-1-carboxylate (CAS 3082507-74-9) is a chemical compound with the molecular formula C15H23N3O4S and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl 3-[2-(4-methylphenyl)sulfonylhydrazinyl]azetidine-1-carboxylate. InChIKey: CPKMAIZAIFWQRT-UHFFFAOYSA-N.
| Molecular formula | C15H23N3O4S |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl 3-[2-(4-methylphenyl)sulfonylhydrazinyl]azetidine-1-carboxylate |
| InChIKey | CPKMAIZAIFWQRT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NNC2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)