CAS 308796-47-6 is the registry number for TRANS-CINNAMIC-D7 ACID, 98 ATOM % D. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.
(E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid (CAS 308796-47-6) is a chemical compound with the molecular formula C9H8O2 and a molecular weight of 155.20 g/mol. IUPAC name: (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid. InChIKey: WBYWAXJHAXSJNI-UJMUNGNDSA-N.
| Molecular formula | C9H8O2 |
|---|---|
| Molecular weight | 155.20 g/mol |
| IUPAC name | (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid |
| InChIKey | WBYWAXJHAXSJNI-UJMUNGNDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C(\[2H])/C(=O)O)/[2H])[2H])[2H] |
Computed by PubChem (NCBI)