Products 308796-47-6

CAS 308796-47-6 is the registry number for TRANS-CINNAMIC-D7 ACID, 98 ATOM % D. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.

Structural formula: {0} (CAS {1})

(E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid (CAS 308796-47-6) is a chemical compound with the molecular formula C9H8O2 and a molecular weight of 155.20 g/mol. IUPAC name: (E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid. InChIKey: WBYWAXJHAXSJNI-UJMUNGNDSA-N.

Identity
Molecular formulaC9H8O2
Molecular weight155.20 g/mol
IUPAC name(E)-2,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid
InChIKeyWBYWAXJHAXSJNI-UJMUNGNDSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C(\[2H])/C(=O)O)/[2H])[2H])[2H]

Computed by PubChem (NCBI)