Products 91453-04-2
CAS 91453-04-2 appears in our catalog under these names: Cinnamic acid–d6, Cinnamic acid-d6, 99.75%, trans-Cinnamic acid-beta,2,3,4,5,6-d6 D. Offered by: GLPBio, MedChemExpress, Sigma-Aldrich. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 250MG.
(E)-3-deuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid (CAS 91453-04-2) is a chemical compound with the molecular formula C9H8O2 and a molecular weight of 154.19 g/mol. IUPAC name: (E)-3-deuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid. InChIKey: WBYWAXJHAXSJNI-UMENIHJVSA-N.
| Molecular formula | C9H8O2 |
|---|---|
| Molecular weight | 154.19 g/mol |
| IUPAC name | (E)-3-deuterio-3-(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid |
| InChIKey | WBYWAXJHAXSJNI-UMENIHJVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C/C(=O)O)/[2H])[2H])[2H] |
Computed by PubChem (NCBI)