Products 3088935-80-9
CAS 3088935-80-9 is the registry number for 2-Propenamide, N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-enamide (CAS 3088935-80-9) is a chemical compound with the molecular formula C14H19BN2O3 and a molecular weight of 274.13 g/mol. IUPAC name: N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-enamide. InChIKey: HVAOUWKXVWNGNH-UHFFFAOYSA-N.
| Molecular formula | C14H19BN2O3 |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-enamide |
| InChIKey | HVAOUWKXVWNGNH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)NC(=O)C=C |
Computed by PubChem (NCBI)