CAS 309293-36-5 is the registry number for N-(4-(4-bromophenyl)(2,5-thiazolyl))-3-pyridylformamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide (CAS 309293-36-5) is a chemical compound with the molecular formula C15H10BrN3OS and a molecular weight of 360.2 g/mol. IUPAC name: N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide. InChIKey: NOEKOUCPUJAYLQ-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3OS |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carboxamide |
| InChIKey | NOEKOUCPUJAYLQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)NC2=NC(=CS2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)