CAS 321430-00-6 is the registry number for N-(4-Bromophenyl)-2-(pyridin-4-yl)thiazole-4-carboxamide, 90%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N-(4-bromophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide (CAS 321430-00-6) is a chemical compound with the molecular formula C15H10BrN3OS and a molecular weight of 360.2 g/mol. IUPAC name: N-(4-bromophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide. InChIKey: JSGPUBGVWVFUIR-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3OS |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-pyridin-4-yl-1,3-thiazole-4-carboxamide |
| InChIKey | JSGPUBGVWVFUIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=CSC(=N2)C3=CC=NC=C3)Br |
Computed by PubChem (NCBI)